* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 6-FLUORO-3-METHYL-1H-INDOLE |
CAS: | 1011484-23-3 |
English Synonyms: | 6-FLUORO-3-METHYL-1H-INDOLE ; 1H-INDOLE, 6-FLUORO-3-METHYL- |
MDL Number.: | MFCD03095358 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | Cc1c[nH]c2c1ccc(c2)F |
InChi: | InChI=1S/C9H8FN/c1-6-5-11-9-4-7(10)2-3-8(6)9/h2-5,11H,1H3 |
InChiKey: | InChIKey=BKFGKRQBSCLQNL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.