* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-HIS-PHE-TRP-OET |
| CAS: | 10119-01-4 |
| English Synonyms: | Z-HIS-PHE-TRP-OET |
| MDL Number.: | MFCD00037941 |
| H bond acceptor: | 12 |
| H bond donor: | 5 |
| Smile: | CCOC(=O)[C@H](Cc1c[nH]c2c1cccc2)NC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](Cc4c[nH]cn4)NC(=O)OCc5ccccc5 |
| InChi: | InChI=1S/C36H38N6O6/c1-2-47-35(45)32(18-26-20-38-29-16-10-9-15-28(26)29)41-33(43)30(17-24-11-5-3-6-12-24)40-34(44)31(19-27-21-37-23-39-27)42-36(46)48-22-25-13-7-4-8-14-25/h3-16,20-21,23,30-32,38H,2,17-19,22H2,1H3,(H,37,39)(H,40,44)(H,41,43)(H,42,46)/t30-,31-,32-/m0/s1 |
| InChiKey: | InChIKey=BDLARIQIBCQXJC-CPCREDONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.