* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | EPTASTIGMINE |
CAS: | 101246-68-8 |
English Synonyms: | EPTASTIGMINE |
MDL Number.: | MFCD00865267 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCCCCCCNC(=O)Oc1ccc2c(c1)[C@@]3(CCN([C@@H]3N2C)C)C |
InChi: | InChI=1S/C21H33N3O2/c1-5-6-7-8-9-13-22-20(25)26-16-10-11-18-17(15-16)21(2)12-14-23(3)19(21)24(18)4/h10-11,15,19H,5-9,12-14H2,1-4H3,(H,22,25)/t19-,21+/m1/s1 |
InChiKey: | InChIKey=RRGMXBQMCUKRLH-CTNGQTDRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.