* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 3-CHLORO-5-PHENYL-1,2,4-THIADIAZOLE |
CAS: | 101495-56-1 |
English Synonyms: | 3-CHLORO-5-PHENYL-1,2,4-THIADIAZOLE |
MDL Number.: | MFCD00835419 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2nc(ns2)Cl |
InChi: | InChI=1S/C8H5ClN2S/c9-8-10-7(12-11-8)6-4-2-1-3-5-6/h1-5H |
InChiKey: | InChIKey=ZGROIHXQCKYCPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.