* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-Methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzo[d]oxazol-2(3H)-one |
CAS: | 1016641-53-4 |
English Synonyms: | 3-METHYL-6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZO[D]OXAZOL-2(3H)-ONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN1C(OC2=C1C=CC(=C2)B2OC(C(O2)(C)C)(C)C)=O |
InChi: | InChI=1S/C14H18BNO4/c1-13(2)14(3,4)20-15(19-13)9-6-7-10-11(8-9)18-12(17)16(10)5/h6-8H,1-5H3 |
InChiKey: | InChIKey=RRKZAEQTNGEFPO-UHFFFAOYSA-N |
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.