* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYLADENINE 1-OXIDE |
CAS: | 10184-51-7 |
English Synonyms: | 9-METHYLADENINE 1-OXIDE |
MDL Number.: | MFCD02752411 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | Cn1cnc2c1nc[n+](c2N)[O-] |
InChi: | InChI=1S/C6H7N5O/c1-10-2-8-4-5(7)11(12)3-9-6(4)10/h2-3H,7H2,1H3 |
InChiKey: | InChIKey=XRJABOXWAYIICL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.