* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzenamine, 3-(4-phenyl-1-piperazinyl)- |
CAS: | 1018648-55-9 |
English Synonyms: | BENZENAMINE, 3-(4-PHENYL-1-PIPERAZINYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C1(=CC=CC=C1)N1CCN(CC1)C=1C=C(C=CC1)N |
InChi: | InChI=1S/C16H19N3/c17-14-5-4-8-16(13-14)19-11-9-18(10-12-19)15-6-2-1-3-7-15/h1-8,13H,9-12,17H2 |
InChiKey: | InChIKey=NSUDUKMRKCCSIV-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.