* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VALANIMYCIN |
| CAS: | 101961-60-8 |
| English Synonyms: | VALANIMYCIN |
| MDL Number.: | MFCD01673863 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC(C)C/[N+](=N\C=C\C(=O)O)/[O-] |
| InChi: | InChI=1S/C7H12N2O3/c1-6(2)5-9(12)8-4-3-7(10)11/h3-4,6H,5H2,1-2H3,(H,10,11)/b4-3+,9-8+ |
| InChiKey: | InChIKey=LSOSZVCOFHAQLR-DDJGDYJSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.