* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | N-(2,4-DINITROPHENYL)PROLINE |
CAS: | 10200-25-6 |
English Synonyms: | N-(2,4-DINITROPHENYL)PROLINE |
MDL Number.: | MFCD03029201 |
H bond acceptor: | 9 |
H bond donor: | 1 |
Smile: | c1cc(c(cc1[N+](=O)[O-])[N+](=O)[O-])N2CCCC2C(=O)O |
InChi: | InChI=1S/C11H11N3O6/c15-11(16)9-2-1-5-12(9)8-4-3-7(13(17)18)6-10(8)14(19)20/h3-4,6,9H,1-2,5H2,(H,15,16) |
InChiKey: | InChIKey=MVZXUWLTGGBNHL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.