* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-4-Methyl-2-(methylamino)pentan-1-ol |
CAS: | 10203-89-1 |
English Synonyms: | (S)-4-METHYL-2-(METHYLAMINO)PENTAN-1-OL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC(C[C@@H](CO)NC)C |
InChi: | InChI=1S/C7H17NO/c1-6(2)4-7(5-9)8-3/h6-9H,4-5H2,1-3H3/t7-/m0/s1 |
InChiKey: | InChIKey=LUAXDSKCXOZUGI-ZETCQYMHSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.