* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-DIETHOXYPROPANE |
CAS: | 10221-57-5 |
English Synonyms: | 1,2-DIETHOXYPROPANE ; PROPANE, 1,2-DIETHOXY- |
MDL Number.: | MFCD00797939 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CCOCC(C)OCC |
InChi: | InChI=1S/C7H16O2/c1-4-8-6-7(3)9-5-2/h7H,4-6H2,1-3H3 |
InChiKey: | InChIKey=VPBZZPOGZPKYKX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.