* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Acetic acid, 2-(2-aminoethoxy)-, ethyl ester |
CAS: | 1023653-54-4 |
English Synonyms: | ACETIC ACID, 2-(2-AMINOETHOXY)-, ETHYL ESTER |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | NCCOCC(=O)OCC |
InChi: | InChI=1S/C6H13NO3/c1-2-10-6(8)5-9-4-3-7/h2-5,7H2,1H3 |
InChiKey: | InChIKey=QTSPHTZFRIQURF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.