* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(1,4-BENZODIOXAN-2-YLMETHYL)-1,3-DI(2-PROPYL)-2,4-DIOXO-1,3,8-TRIAZASPIRO(4.5)DECANE |
| CAS: | 102395-33-5 |
| English Synonyms: | 8-(1,4-BENZODIOXAN-2-YLMETHYL)-1,3-DI(2-PROPYL)-2,4-DIOXO-1,3,8-TRIAZASPIRO(4.5)DECANE |
| MDL Number.: | MFCD01679427 |
| H bond acceptor: | 7 |
| H bond donor: | 0 |
| Smile: | CC(C)N1C(=O)C2(CCN(CC2)CC3COc4ccccc4O3)N(C1=O)C(C)C |
| InChi: | InChI=1S/C22H31N3O4/c1-15(2)24-20(26)22(25(16(3)4)21(24)27)9-11-23(12-10-22)13-17-14-28-18-7-5-6-8-19(18)29-17/h5-8,15-17H,9-14H2,1-4H3 |
| InChiKey: | InChIKey=QWLAOHSLVVDZMJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.