* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(2-(1,4-BENZODIOXANYL-2)ETHYL)-3-METHYL-4-OXO-1-PHENYL-1,3,8-TRIAZASPIRO(4.5)DECANE |
| CAS: | 102395-45-9 |
| English Synonyms: | 8-(2-(1,4-BENZODIOXANYL-2)ETHYL)-3-METHYL-4-OXO-1-PHENYL-1,3,8-TRIAZASPIRO(4.5)DECANE |
| MDL Number.: | MFCD01679417 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | CN1CN(C2(C1=O)CCN(CC2)CCC3COc4ccccc4O3)c5ccccc5 |
| InChi: | InChI=1S/C24H29N3O3/c1-25-18-27(19-7-3-2-4-8-19)24(23(25)28)12-15-26(16-13-24)14-11-20-17-29-21-9-5-6-10-22(21)30-20/h2-10,20H,11-18H2,1H3 |
| InChiKey: | InChIKey=VTJGTOAUDCODNK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.