* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,1'-(P-XYLYLENE)BIS(3-(1-AZIRIDINYL)UREA |
CAS: | 102584-86-1 |
English Synonyms: | 1,1'-(P-XYLYLENE)BIS(3-(1-AZIRIDINYL)UREA |
MDL Number.: | MFCD01675741 |
H bond acceptor: | 8 |
H bond donor: | 4 |
Smile: | c1cc(ccc1CNC(=O)NN2CC2)CNC(=O)NN3CC3 |
InChi: | InChI=1S/C14H20N6O2/c21-13(17-19-5-6-19)15-9-11-1-2-12(4-3-11)10-16-14(22)18-20-7-8-20/h1-4H,5-10H2,(H2,15,17,21)(H2,16,18,22) |
InChiKey: | InChIKey=ZJQGNIVCRCDNTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.