* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PHENYL-1,2,3,4-TETRAHYDROACRIDINE |
CAS: | 10265-83-5 |
English Synonyms: | 9-PHENYL-1,2,3,4-TETRAHYDROACRIDINE |
MDL Number.: | MFCD03413718 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)c2c3ccccc3nc4c2CCCC4 |
InChi: | InChI=1S/C19H17N/c1-2-8-14(9-3-1)19-15-10-4-6-12-17(15)20-18-13-7-5-11-16(18)19/h1-4,6,8-10,12H,5,7,11,13H2 |
InChiKey: | InChIKey=KVWQMXDWBOKOIH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.