* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Benzoic acid, 4-[(8-carboxyoctyl)oxy]- |
CAS: | 1030939-31-1 |
English Synonyms: | BENZOIC ACID, 4-[(8-CARBOXYOCTYL)OXY]- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(=O)(O)CCCCCCCCOC1=CC=C(C(=O)O)C=C1 |
InChi: | InChI=1S/C16H22O5/c17-15(18)7-5-3-1-2-4-6-12-21-14-10-8-13(9-11-14)16(19)20/h8-11H,1-7,12H2,(H,17,18)(H,19,20) |
InChiKey: | InChIKey=CTMSWXGEKCNZHM-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.