* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | [1,1'-Biphenyl]-3,5-diol, 4'-(2-hydroxyethyl)- |
CAS: | 1035100-09-4 |
English Synonyms: | [1,1'-BIPHENYL]-3,5-DIOL, 4'-(2-HYDROXYETHYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | OCCC1=CC=C(C=C1)C1=CC(=CC(=C1)O)O |
InChi: | InChI=1S/C14H14O3/c15-6-5-10-1-3-11(4-2-10)12-7-13(16)9-14(17)8-12/h1-4,7-9,15-17H,5-6H2 |
InChiKey: | InChIKey=AHCJTSMIQMWSCY-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.