Molecular Structure:
CAS No.:
103773-62-2
;98296-48-1
Product Name.:
CCD No.:CCD00443757
Formula:C30 H46 O7
MolWeight:518.686
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(6)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(2)
|
|
| Product Name： | GANODERIC ACID C2 |
| CAS： | 103773-62-2 ;98296-48-1 |
| English Synonyms： | GANODERIC ACID C2 |
| MDL Number.： | MFCD04039842 |
| H bond acceptor： | 7 |
| H bond donor： | 4 |
| Smile： | C[C@H](CC(=O)C[C@@H](C)C(=O)O)[C@H]1C[C@@H]([C@@]2([C@@]1(CC(=O)C3=C2[C@H](C[C@@H]4[C@@]3(CC[C@@H](C4(C)C)O)C)O)C)C)O |
| InChi： | InChI=1S/C30H46O7/c1-15(10-17(31)11-16(2)26(36)37)18-12-23(35)30(7)25-19(32)13-21-27(3,4)22(34)8-9-28(21,5)24(25)20(33)14-29(18,30)6/h15-16,18-19,21-23,32,34-35H,8-14H2,1-7H3,(H,36,37)/t15-,16-,18-,19+,21+,22+,23+,28+,29-,30+/m1/s1 |
| InChiKey： | InChIKey=RERVSJVGWKIGTJ-RQLZKMEDSA-N |
|
|
| Melting Point： | 231-232 DEG C |
| Specification： | PRIMARY STANDARD |
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
