* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-AMINO-5,6,7,8-TETRAHYDRONAPHTHALEN-2-OL |
| CAS: | 103791-24-8 |
| English Synonyms: | 8-AMINO-5,6,7,8-TETRAHYDRONAPHTHALEN-2-OL |
| MDL Number.: | MFCD17010014 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1cc2c(cc1O)C(CCC2)N |
| InChi: | InChI=1S/C10H13NO/c11-10-3-1-2-7-4-5-8(12)6-9(7)10/h4-6,10,12H,1-3,11H2 |
| InChiKey: | InChIKey=SXQYMLTXGOSXPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.