* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BARIUM DIURANATE |
CAS: | 10380-31-1 |
English Synonyms: | BARIUM DIURANATE |
MDL Number.: | MFCD19443402 |
H bond acceptor: | 7 |
H bond donor: | 0 |
Smile: | O=[U]1(=O)O[Ba]O[U](=O)(=O)O1 |
InChi: | InChI=1S/Ba.7O.2U |
InChiKey: | InChIKey=GGCLDUUTHRAMGD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.