* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | L-Phenylalanine, 2-fluoro-4-methyl- |
CAS: | 1039031-55-4 |
English Synonyms: | L-PHENYLALANINE, 2-FLUORO-4-METHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | FC1=C(C[C@H](N)C(=O)O)C=CC(=C1)C |
InChi: | InChI=1S/C10H12FNO2/c1-6-2-3-7(8(11)4-6)5-9(12)10(13)14/h2-4,9H,5,12H2,1H3,(H,13,14)/t9-/m0/s1 |
InChiKey: | InChIKey=ZWMXOQFVRKESMD-VIFPVBQESA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.