* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-2-Aminobutane-1,4-diol |
CAS: | 10405-07-9 |
English Synonyms: | (S)-2-AMINOBUTANE-1,4-DIOL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | N[C@H](CO)CCO |
InChi: | InChI=1S/C4H11NO2/c5-4(3-7)1-2-6/h4,6-7H,1-3,5H2/t4-/m0/s1 |
InChiKey: | InChIKey=PYBVXNWDSBYQSA-BYPYZUCNSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.