* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | Z-TYR-TYR-OH |
| CAS: | 10417-83-1 |
| English Synonyms: | Z-TYR-TYR-OH |
| MDL Number.: | MFCD00020196 |
| H bond acceptor: | 9 |
| H bond donor: | 5 |
| Smile: | c1ccc(cc1)COC(=O)N[C@@H](Cc2ccc(cc2)O)C(=O)N[C@@H](Cc3ccc(cc3)O)C(=O)O |
| InChi: | InChI=1S/C26H26N2O7/c29-20-10-6-17(7-11-20)14-22(28-26(34)35-16-19-4-2-1-3-5-19)24(31)27-23(25(32)33)15-18-8-12-21(30)13-9-18/h1-13,22-23,29-30H,14-16H2,(H,27,31)(H,28,34)(H,32,33)/t22-,23-/m0/s1 |
| InChiKey: | InChIKey=IDAUTLPLQAQNMW-GOTSBHOMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.