* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9H-Carbazole, 9-(4-bromobutyl)- |
CAS: | 10420-20-9 |
English Synonyms: | 9H-CARBAZOLE, 9-(4-BROMOBUTYL)- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCCCCN1C2=CC=CC=C2C=2C=CC=CC12 |
InChi: | InChI=1S/C16H16BrN/c17-11-5-6-12-18-15-9-3-1-7-13(15)14-8-2-4-10-16(14)18/h1-4,7-10H,5-6,11-12H2 |
InChiKey: | InChIKey=IXCQFUSWIBGIQG-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.