* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-METHYL-1H-PYRROLE-1-ETHANOL |
CAS: | 104803-80-7 |
English Synonyms: | 2-METHYL-1H-PYRROLE-1-ETHANOL |
MDL Number.: | MFCD03013612 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | Cc1cccn1CCO |
InChi: | InChI=1S/C7H11NO/c1-7-3-2-4-8(7)5-6-9/h2-4,9H,5-6H2,1H3 |
InChiKey: | InChIKey=FBKRNPLLIWQEPY-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.