* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOPROPANOL[2-14C] |
CAS: | 104810-30-2 |
English Synonyms: | ISOPROPANOL[2-14C] |
MDL Number.: | MFCD00070336 |
H bond acceptor: | 1 |
H bond donor: | 1 |
Smile: | C[14CH](C)O |
InChi: | InChI=1S/C3H8O/c1-3(2)4/h3-4H,1-2H3/i3+2 |
InChiKey: | InChIKey=KFZMGEQAYNKOFK-YZRHJBSPSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.