* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4,5-bis(bromomethyl)-1,3-dioxolane-2-thione |
CAS: | 1051374-80-1 |
English Synonyms: | 4,5-BIS(BROMOMETHYL)-1,3-DIOXOLANE-2-THIONE |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | BrCC1OC(OC1CBr)=S |
InChi: | InChI=1S/C5H6Br2O2S/c6-1-3-4(2-7)9-5(10)8-3/h3-4H,1-2H2 |
InChiKey: | InChIKey=FWPCYRCPYXMPSI-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.