* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | (S)-2-(Methylamino)butan-1-ol |
CAS: | 105157-71-9 |
English Synonyms: | (S)-2-(METHYLAMINO)BUTAN-1-OL |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CN[C@H](CO)CC |
InChi: | InChI=1S/C5H13NO/c1-3-5(4-7)6-2/h5-7H,3-4H2,1-2H3/t5-/m0/s1 |
InChiKey: | InChIKey=HSHIHFMFJLIQDN-YFKPBYRVSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.