* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2,4-DINITROPHENOL-UL-14C |
| CAS: | 105184-16-5 |
| English Synonyms: | 2,4-DINITROPHENOL-UL-14C |
| MDL Number.: | MFCD00069863 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | [14cH]1[14cH][14c]([14c]([14cH][14c]1[N+](=O)[O-])[N+](=O)[O-])O |
| InChi: | InChI=1S/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H/i1+2,2+2,3+2,4+2,5+2,6+2 |
| InChiKey: | InChIKey=UFBJCMHMOXMLKC-YROCTSJKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.