* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMOIMIDAZO[1,5-A]PYRIDINE |
| CAS: | 1052271-60-9 |
| English Synonyms: | IMIDAZO[1,5-A]PYRIDINE, 8-BROMO- ; 8-BROMOIMIDAZO[1,5-A]PYRIDINE |
| MDL Number.: | MFCD18074254 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1cc(c2cncn2c1)Br |
| InChi: | InChI=1S/C7H5BrN2/c8-6-2-1-3-10-5-9-4-7(6)10/h1-5H |
| InChiKey: | InChIKey=YETMJXPCEJHPRW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.