* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | ALONACIC |
CAS: | 105292-70-4 |
English Synonyms: | ALONACIC |
MDL Number.: | MFCD00869131 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC1N[C@@H](CS1)C(=O)NCCC(=O)OC |
InChi: | InChI=1S/C9H16N2O3S/c1-6-11-7(5-15-6)9(13)10-4-3-8(12)14-2/h6-7,11H,3-5H2,1-2H3,(H,10,13)/t6?,7-/m0/s1 |
InChiKey: | InChIKey=FWRHVNGHMPEEOH-MLWJPKLSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.