* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | Glycine, N-2-propen-1-yl-, methyl ester |
CAS: | 10552-80-4 |
English Synonyms: | GLYCINE, N-2-PROPEN-1-YL-, METHYL ESTER |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(C=C)NCC(=O)OC |
InChi: | InChI=1S/C6H11NO2/c1-3-4-7-5-6(8)9-2/h3,7H,1,4-5H2,2H3 |
InChiKey: | InChIKey=NXDPEGBGHJHNSR-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.