* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 2-(3-METHOXYPROP-1-EN-2-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE |
CAS: | 1055881-27-0 ;165904-29-0 |
English Synonyms: | 2-(3-METHOXYPROP-1-EN-2-YL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE |
MDL Number.: | MFCD16996229 |
H bond acceptor: | 3 |
H bond donor: | 0 |
Smile: | B1(OC(C(O1)(C)C)(C)C)C(=C)COC |
InChi: | InChI=1S/C10H19BO3/c1-8(7-12-6)11-13-9(2,3)10(4,5)14-11/h1,7H2,2-6H3 |
InChiKey: | InChIKey=CIKBASZWGDPBIB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.