* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GITOXIGENIN 3-ACETATE |
| CAS: | 1059-21-8 |
| English Synonyms: | GITOXIGENIN 3-ACETATE |
| MDL Number.: | MFCD00012253 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | CC(=O)O[C@H]1CC[C@]2(C(C1)CC[C@@H]3[C@@H]2CC[C@]4([C@@]3(C[C@@H]([C@@H]4C5=CC(=O)OC5)O)O)C)C |
| InChi: | InChI=1S/C25H36O6/c1-14(26)31-17-6-8-23(2)16(11-17)4-5-19-18(23)7-9-24(3)22(15-10-21(28)30-13-15)20(27)12-25(19,24)29/h10,16-20,22,27,29H,4-9,11-13H2,1-3H3/t16?,17-,18-,19+,20-,22-,23-,24+,25-/m0/s1 |
| InChiKey: | InChIKey=IBVUJOOHHPQIOV-ZVIQYDNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.