* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CIS-2,14-DIAMINODIBENZOTHIAZOLO(6,5-B,6,5-K)-18-CROWN-6 |
CAS: | 106000-45-7 |
English Synonyms: | CIS-2,14-DIAMINODIBENZOTHIAZOLO(6,5-B,6,5-K)-18-CROWN-6 |
MDL Number.: | MFCD01723233 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | c1c2c(cc3c1OCCOCCOc4cc5c(cc4OCCOCCO3)sc(n5)N)sc(n2)N |
InChi: | InChI=1S/C22H24N4O6S2/c23-21-25-13-9-15-17(11-19(13)33-21)31-7-3-28-4-8-32-18-12-20-14(26-22(24)34-20)10-16(18)30-6-2-27-1-5-29-15/h9-12H,1-8H2,(H2,23,25)(H2,24,26) |
InChiKey: | InChIKey=DSQBDTLELYWTFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.