* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-PHENYL-3,3'-BI-9H-CARBAZOLE |
CAS: | 1060735-14-9 |
English Synonyms: | 9'-PHENYL-9H,9H'-[3,3']BICARBAZOLYL ; 9-PHENYL-3,3'-BI-9H-CARBAZOLE |
MDL Number.: | MFCD22581311 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)n2c3ccccc3c4c2ccc(c4)c5ccc6c(c5)c7ccccc7[nH]6 |
InChi: | InChI=1S/C30H20N2/c1-2-8-22(9-3-1)32-29-13-7-5-11-24(29)26-19-21(15-17-30(26)32)20-14-16-28-25(18-20)23-10-4-6-12-27(23)31-28/h1-19,31H |
InChiKey: | InChIKey=GKTLHQFSIDFAJH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.