* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ARGINOMYCIN |
CAS: | 106133-33-9 |
English Synonyms: | ARGINOMYCIN |
MDL Number.: | MFCD01723156 |
H bond acceptor: | 13 |
H bond donor: | 6 |
Smile: | CC(CCN(C)C(=N)N)C(C(=O)N[C@H]1C=C[C@@H](O[C@@H]1C(=O)O)n2ccc(nc2=O)N)N |
InChi: | InChI=1S/C18H28N8O5/c1-9(5-7-25(2)17(21)22)13(20)15(27)23-10-3-4-12(31-14(10)16(28)29)26-8-6-11(19)24-18(26)30/h3-4,6,8-10,12-14H,5,7,20H2,1-2H3,(H3,21,22)(H,23,27)(H,28,29)(H2,19,24,30)/t9?,10-,12+,13?,14-/m0/s1 |
InChiKey: | InChIKey=QHXNKYPHTJBRJV-FOMLMUQCSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.