* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DENIPRIDE |
| CAS: | 106972-33-2 |
| English Synonyms: | DENIPRIDE |
| MDL Number.: | MFCD00868350 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COc1cc(c(cc1C(=O)NC2CCN(CC2)CC3CCCO3)[N+](=O)[O-])N |
| InChi: | InChI=1S/C18H26N4O5/c1-26-17-10-15(19)16(22(24)25)9-14(17)18(23)20-12-4-6-21(7-5-12)11-13-3-2-8-27-13/h9-10,12-13H,2-8,11,19H2,1H3,(H,20,23) |
| InChiKey: | InChIKey=WUIJEMRFIZSWPL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.