* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-METHYL-2,5-DIHYDRO-1H-PYRROLE-2,5-DIONE |
| CAS: | 1072-87-3 |
| English Synonyms: | 3-METHYL-1H-PYRROLE-2,5-DIONE ; 3-METHYL-2,5-DIHYDRO-1H-PYRROLE-2,5-DIONE |
| MDL Number.: | MFCD10699598 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1=CC(=O)NC1=O |
| InChi: | InChI=1S/C5H5NO2/c1-3-2-4(7)6-5(3)8/h2H,1H3,(H,6,7,8) |
| InChiKey: | InChIKey=ZLPORNPZJNRGCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.