* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | INDAZOLE-5-THIOL, 1-METHYL- |
| CAS: | 1072433-60-3 |
| English Synonyms: | INDAZOLE-5-THIOL, 1-METHYL- |
| MDL Number.: | MFCD17010074 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | Cn1c2ccc(cc2cn1)S |
| InChi: | InChI=1S/C8H8N2S/c1-10-8-3-2-7(11)4-6(8)5-9-10/h2-5,11H,1H3 |
| InChiKey: | InChIKey=XWBFBVNWYSDXRA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.