* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2-[1(1-ACETYL-2-OXOPROPYL)THIO]-1H-ISOINDOLE-1,3(2H)-DIONE |
CAS: | 107552-89-6 |
English Synonyms: | 2-[1(1-ACETYL-2-OXOPROPYL)THIO]-1H-ISOINDOLE-1,3(2H)-DIONE |
MDL Number.: | MFCD16876455 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | CC(=O)C(C(=O)C)SN1C(=O)c2ccccc2C1=O |
InChi: | InChI=1S/C13H11NO4S/c1-7(15)11(8(2)16)19-14-12(17)9-5-3-4-6-10(9)13(14)18/h3-6,11H,1-2H3 |
InChiKey: | InChIKey=YTUQAKQNUXTCOX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.