* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 4-CHLORO-6,7,8,9-TETRAHYDROPYRIDO[1,2-E]PURINE |
CAS: | 108106-76-9 |
English Synonyms: | 4-CHLORO-6,7,8,9-TETRAHYDROPYRIDO[1,2-E]PURINE |
MDL Number.: | MFCD16991368 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | c1nc2c(c(n1)Cl)nc3n2CCCC3 |
InChi: | InChI=1S/C9H9ClN4/c10-8-7-9(12-5-11-8)14-4-2-1-3-6(14)13-7/h5H,1-4H2 |
InChiKey: | InChIKey=BXUAHIZVMYTRKV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.