* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,3-Propanediamine, 1-(3,4-dichlorophenyl)-N3,N3-dimethyl- |
CAS: | 1082118-90-8 |
English Synonyms: | 1,3-PROPANEDIAMINE, 1-(3,4-DICHLOROPHENYL)-N3,N3-DIMETHYL- |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | ClC=1C=C(C=CC1Cl)C(CCN(C)C)N |
InChi: | InChI=1S/C11H16Cl2N2/c1-15(2)6-5-11(14)8-3-4-9(12)10(13)7-8/h3-4,7,11H,5-6,14H2,1-2H3 |
InChiKey: | InChIKey=WTQOBBOBZRRUFF-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.