* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | L-ARGINYL GLYCINE |
| CAS: | 2418-67-9 ;108347-93-9 |
| English Synonyms: | L-ARGINYL GLYCINE ; H-ARG-GLY-OH |
| MDL Number.: | MFCD00069589 |
| H bond acceptor: | 8 |
| H bond donor: | 6 |
| Smile: | C(C[C@@H](C(=O)NCC(=O)O)N)CNC(=N)N |
| InChi: | InChI=1S/C8H17N5O3/c9-5(2-1-3-12-8(10)11)7(16)13-4-6(14)15/h5H,1-4,9H2,(H,13,16)(H,14,15)(H4,10,11,12)/t5-/m0/s1 |
| InChiKey: | InChIKey=XUUXCWCKKCZEAW-YFKPBYRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.