* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ROCICLOVIR |
CAS: | 108436-80-2 |
English Synonyms: | ROCICLOVIR |
MDL Number.: | MFCD00866940 |
H bond acceptor: | 8 |
H bond donor: | 1 |
Smile: | CC(C)OCC(COC(C)C)OCn1cnc2c1nc(nc2)N |
InChi: | InChI=1S/C15H25N5O3/c1-10(2)21-6-12(7-22-11(3)4)23-9-20-8-18-13-5-17-15(16)19-14(13)20/h5,8,10-12H,6-7,9H2,1-4H3,(H2,16,17,19) |
InChiKey: | InChIKey=FBHWXSOQXQBXER-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.