* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | EBOB |
| CAS: | 108614-26-2 |
| English Synonyms: | 1-(4-ETHYNYLPHENYL)-4-PROPYL-2,6,7-TRIOXABICYCLO(2.2.2)OCTANE ; EBOB |
| MDL Number.: | MFCD01677634 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | CCC[C@]12CO[C@](OC1)(OC2)c3ccc(cc3)C#C |
| InChi: | InChI=1S/C16H18O3/c1-3-9-15-10-17-16(18-11-15,19-12-15)14-7-5-13(4-2)6-8-14/h2,5-8H,3,9-12H2,1H3/t15-,16+ |
| InChiKey: | InChIKey=HFUCNMPQEAYQDJ-IYBDPMFKSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.