* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 1,2-DIBROMO-4-CHLOROBUTANE |
CAS: | 108963-23-1 |
English Synonyms: | 1,2-DIBROMO-4-CHLOROBUTANE |
MDL Number.: | MFCD02751687 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | C(CCl)C(CBr)Br |
InChi: | InChI=1S/C4H7Br2Cl/c5-3-4(6)1-2-7/h4H,1-3H2 |
InChiKey: | InChIKey=DAZXKDNMZIGPQQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.