* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ABBYPHARMA AP-10-1602 |
CAS: | 1092284-90-6 |
English Synonyms: | ABBYPHARMA AP-10-1602 |
MDL Number.: | MFCD16988159 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CC1=CC(=O)NC(=N1)C(O)=O |
InChi: | InChI=1S/C6H6N2O3/c1-3-2-4(9)8-5(7-3)6(10)11/h2H,1H3,(H,10,11)(H,7,8,9) |
InChiKey: | InChIKey=MVUGCOXOYCZYFR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.