Molecular Structure:
CAS No.:
1092394-16-5
Product Name.:
CCD No.:CCD03286406
Formula:C6 H6 N4 O . Br H
MolWeight:231.052
![2-AMINO[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-OL HYDROBROMIDE Detailed](../images/deli.png)
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(10)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(1)
|
|
| Product Name： | 2-AMINO[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-OL HYDROBROMIDE |
| CAS： | 1092394-16-5 |
| English Synonyms： | 2-AMINO[1,2,4]TRIAZOLO[1,5-A]PYRIDIN-6-OL HYDROBROMIDE |
| MDL Number.： | MFCD17014843 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1cc2nc(nn2cc1O)N.Br |
| InChi： | InChI=1S/C6H6N4O.BrH/c7-6-8-5-2-1-4(11)3-10(5)9-6;/h1-3,11H,(H2,7,9);1H |
| InChiKey： | InChIKey=HSFWPMATVTVYPC-UHFFFAOYSA-N |
|
|
|
|
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
